C15H23N3O2S — CID 103428671
3-amino-N,4-dicyclopropyl-5-(2-ethoxyethylamino)thiophene-2-carboxamide (PubChem CID 103428671) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-amino-N,4-dicyclopropyl-5-(2-ethoxyethylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N,4-dicyclopropyl-5-(2-ethoxyethylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103428671 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-amino-N,4-dicyclopropyl-5-(2-ethoxyethylamino)thiophene-2-carboxamide |
| SMILES | CCOCCNc1sc(C(=O)NC2CC2)c(N)c1C1CC1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-20-8-7-17-15-11(9-3-4-9)12(16)13(21-15)14(19)18-10-5-6-10/h9-10,17H,2-8,16H2,1H3,(H,18,19) |
| InChIKey | OMLXJAMSRUTNIM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|