C15H21N3OS — CID 103507326
3-amino-N,4-dicyclopropyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide (PubChem CID 103507326) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-amino-N,4-dicyclopropyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N,4-dicyclopropyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507326 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-amino-N,4-dicyclopropyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide |
| SMILES | C=C(C)CNc1sc(C(=O)NC2CC2)c(N)c1C1CC1 |
| InChI | InChI=1S/C15H21N3OS/c1-8(2)7-17-15-11(9-3-4-9)12(16)13(20-15)14(19)18-10-5-6-10/h9-10,17H,1,3-7,16H2,2H3,(H,18,19) |
| InChIKey | GQZSZTDIHMVMMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|