C14H14BrNO — CID 103434425
2-bromo-6-(2-methoxy-3,4-dimethylphenyl)pyridine (PubChem CID 103434425) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is 2-bromo-6-(2-methoxy-3,4-dimethylphenyl)pyridine.
| Compound Name | 2-bromo-6-(2-methoxy-3,4-dimethylphenyl)pyridine |
|---|---|
| PubChem CID | 103434425 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-bromo-6-(2-methoxy-3,4-dimethylphenyl)pyridine |
| SMILES | COc1c(-c2cccc(Br)n2)ccc(C)c1C |
| InChI | InChI=1S/C14H14BrNO/c1-9-7-8-11(14(17-3)10(9)2)12-5-4-6-13(15)16-12/h4-8H,1-3H3 |
| InChIKey | FQFUIGVCVTWWKS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|