C16H20N2OS — CID 106523150
2-ethyl-6-(2-methoxy-3,4-dimethylphenyl)-5-methyl-1H-pyrimidine-4-thione (PubChem CID 106523150) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-ethyl-6-(2-methoxy-3,4-dimethylphenyl)-5-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2-ethyl-6-(2-methoxy-3,4-dimethylphenyl)-5-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106523150 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-ethyl-6-(2-methoxy-3,4-dimethylphenyl)-5-methyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)c(C)c(-c2ccc(C)c(C)c2OC)[nH]1 |
| InChI | InChI=1S/C16H20N2OS/c1-6-13-17-14(11(4)16(20)18-13)12-8-7-9(2)10(3)15(12)19-5/h7-8H,6H2,1-5H3,(H,17,18,20) |
| InChIKey | OOCPTXAUBLYLDK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|