C15H21ClF2N2O — CID 103441656
[1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-methylpiperidin-2-yl]methanamine (PubChem CID 103441656) has the molecular formula C15H21ClF2N2O and a molecular weight of 318.80 g/mol. Its IUPAC name is [1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-methylpiperidin-2-yl]methanamine.
| Compound Name | [1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-methylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 103441656 |
| Molecular Formula | C15H21ClF2N2O |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-methylpiperidin-2-yl]methanamine |
| SMILES | CC1CCN(Cc2cc(Cl)ccc2OC(F)F)C(CN)C1 |
| InChI | InChI=1S/C15H21ClF2N2O/c1-10-4-5-20(13(6-10)8-19)9-11-7-12(16)2-3-14(11)21-15(17)18/h2-3,7,10,13,15H,4-6,8-9,19H2,1H3 |
| InChIKey | UUSBJENIJMXPCN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |