C13H12Cl2O — CID 103448039
1-(cyclopenten-1-yl)-2-(2,4-dichlorophenyl)ethanone (PubChem CID 103448039) has the molecular formula C13H12Cl2O and a molecular weight of 255.14 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-2-(2,4-dichlorophenyl)ethanone.
| Compound Name | 1-(cyclopenten-1-yl)-2-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 103448039 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(cyclopenten-1-yl)-2-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1=CCCC1 |
| InChI | InChI=1S/C13H12Cl2O/c14-11-6-5-10(12(15)8-11)7-13(16)9-3-1-2-4-9/h3,5-6,8H,1-2,4,7H2 |
| InChIKey | XBRUHMQKPNVKPS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |