C15H16ClFO — CID 103451060
2-(4-chloro-2-fluorophenyl)-1-(4-methylcyclohexen-1-yl)ethanone (PubChem CID 103451060) has the molecular formula C15H16ClFO and a molecular weight of 266.74 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-(4-methylcyclohexen-1-yl)ethanone.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-(4-methylcyclohexen-1-yl)ethanone |
|---|---|
| PubChem CID | 103451060 |
| Molecular Formula | C15H16ClFO |
| Molecular Weight | 266.74 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-(4-methylcyclohexen-1-yl)ethanone |
| SMILES | CC1CC=C(C(=O)Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C15H16ClFO/c1-10-2-4-11(5-3-10)15(18)8-12-6-7-13(16)9-14(12)17/h4,6-7,9-10H,2-3,5,8H2,1H3 |
| InChIKey | PJOAHZAEKHEXHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.74 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |