C14H13F3O — CID 103451241
(4-methylcyclohexen-1-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 103451241) has the molecular formula C14H13F3O and a molecular weight of 254.25 g/mol. Its IUPAC name is (4-methylcyclohexen-1-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (4-methylcyclohexen-1-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103451241 |
| Molecular Formula | C14H13F3O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (4-methylcyclohexen-1-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | CC1CC=C(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C14H13F3O/c1-8-2-4-9(5-3-8)14(18)10-6-7-11(15)13(17)12(10)16/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | MYXTUDFSNAMEMU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|