C12H18O3 — CID 103459035
1-cyclohexyl-2-(furan-3-yl)ethane-1,2-diol (PubChem CID 103459035) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-cyclohexyl-2-(furan-3-yl)ethane-1,2-diol.
| Compound Name | 1-cyclohexyl-2-(furan-3-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 103459035 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-cyclohexyl-2-(furan-3-yl)ethane-1,2-diol |
| SMILES | OC(c1ccoc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C12H18O3/c13-11(9-4-2-1-3-5-9)12(14)10-6-7-15-8-10/h6-9,11-14H,1-5H2 |
| InChIKey | FMQYOKAWQVTWML-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |