C13H20O3 — CID 103458978
1-cyclohexyl-3-(furan-3-yl)propane-1,2-diol (PubChem CID 103458978) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-cyclohexyl-3-(furan-3-yl)propane-1,2-diol.
| Compound Name | 1-cyclohexyl-3-(furan-3-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 103458978 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-cyclohexyl-3-(furan-3-yl)propane-1,2-diol |
| SMILES | OC(Cc1ccoc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C13H20O3/c14-12(8-10-6-7-16-9-10)13(15)11-4-2-1-3-5-11/h6-7,9,11-15H,1-5,8H2 |
| InChIKey | LULXHUDDRCGOAG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |