C11H16FNO — CID 106635035
2-[1-fluoro-2-(furan-3-yl)ethyl]piperidine (PubChem CID 106635035) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 2-[1-fluoro-2-(furan-3-yl)ethyl]piperidine.
| Compound Name | 2-[1-fluoro-2-(furan-3-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 106635035 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[1-fluoro-2-(furan-3-yl)ethyl]piperidine |
| SMILES | FC(Cc1ccoc1)C1CCCCN1 |
| InChI | InChI=1S/C11H16FNO/c12-10(7-9-4-6-14-8-9)11-3-1-2-5-13-11/h4,6,8,10-11,13H,1-3,5,7H2 |
| InChIKey | HOLRJNCCYWLDFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |