C11H15BrFNS — CID 106635056
2-[2-(3-bromothiophen-2-yl)-1-fluoroethyl]piperidine (PubChem CID 106635056) has the molecular formula C11H15BrFNS and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-[2-(3-bromothiophen-2-yl)-1-fluoroethyl]piperidine.
| Compound Name | 2-[2-(3-bromothiophen-2-yl)-1-fluoroethyl]piperidine |
|---|---|
| PubChem CID | 106635056 |
| Molecular Formula | C11H15BrFNS |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[2-(3-bromothiophen-2-yl)-1-fluoroethyl]piperidine |
| SMILES | FC(Cc1sccc1Br)C1CCCCN1 |
| InChI | InChI=1S/C11H15BrFNS/c12-8-4-6-15-11(8)7-9(13)10-3-1-2-5-14-10/h4,6,9-10,14H,1-3,5,7H2 |
| InChIKey | IVLRUJQODKFXRS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |