C16H33N — CID 103460679
2-tert-butyl-N-(2,2-dimethylbutyl)cyclohexan-1-amine (PubChem CID 103460679) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,2-dimethylbutyl)cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-N-(2,2-dimethylbutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 103460679 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 2-tert-butyl-N-(2,2-dimethylbutyl)cyclohexan-1-amine |
| SMILES | CCC(C)(C)CNC1CCCCC1C(C)(C)C |
| InChI | InChI=1S/C16H33N/c1-7-16(5,6)12-17-14-11-9-8-10-13(14)15(2,3)4/h13-14,17H,7-12H2,1-6H3 |
| InChIKey | MFBLHFUYIBQUJT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |