C11H19N3OS — CID 103461497
2-(2-amino-1,3-thiazol-4-yl)-N-(2,2-dimethylbutyl)acetamide (PubChem CID 103461497) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-(2,2-dimethylbutyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(2,2-dimethylbutyl)acetamide |
|---|---|
| PubChem CID | 103461497 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(2,2-dimethylbutyl)acetamide |
| SMILES | CCC(C)(C)CNC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C11H19N3OS/c1-4-11(2,3)7-13-9(15)5-8-6-16-10(12)14-8/h6H,4-5,7H2,1-3H3,(H2,12,14)(H,13,15) |
| InChIKey | FTYJFUPZAFNWSN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |