C24H41IO2Si — CID 10346459
(1R,2R,3R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol (PubChem CID 10346459) has the molecular formula C24H41IO2Si and a molecular weight of 516.58 g/mol. Its IUPAC name is (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol.
| Compound Name | (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol |
|---|---|
| PubChem CID | 10346459 |
| Molecular Formula | C24H41IO2Si |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol |
| SMILES | C/C(I)=C/C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CCC2=CCC[C@]3(C)[C@H]([C@@H]1O)[C@H]23 |
| InChI | InChI=1S/C24H41IO2Si/c1-16(25)10-11-18(15-27-28(6,7)23(2,3)4)19-13-12-17-9-8-14-24(5)20(17)21(24)22(19)26/h9-10,18-22,26H,8,11-15H2,1-7H3/b16-10-/t18-,19-,20+,21+,22-,24+/m1/s1 |
| InChIKey | IDMAFRNAJHSMGL-KVPJTYFESA-N |
| XLogP | 7.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|