C24H40O2Si — CID 10023200
(2R,3R,4S,11R,12S)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,15-dimethyltetracyclo[9.4.0.02,4.03,8]pentadeca-7,14-dien-1-ol (PubChem CID 10023200) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (2R,3R,4S,11R,12S)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,15-dimethyltetracyclo[9.4.0.02,4.03,8]pentadeca-7,14-dien-1-ol.
| Compound Name | (2R,3R,4S,11R,12S)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,15-dimethyltetracyclo[9.4.0.02,4.03,8]pentadeca-7,14-dien-1-ol |
|---|---|
| PubChem CID | 10023200 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2R,3R,4S,11R,12S)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,15-dimethyltetracyclo[9.4.0.02,4.03,8]pentadeca-7,14-dien-1-ol |
| SMILES | CC1=CC[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2CCC3=CCC[C@@]4(C)[C@@H]3[C@H]4C12O |
| InChI | InChI=1S/C24H40O2Si/c1-16-10-11-18(15-26-27(6,7)22(2,3)4)19-13-12-17-9-8-14-23(5)20(17)21(23)24(16,19)25/h9-10,18-21,25H,8,11-15H2,1-7H3/t18-,19-,20+,21-,23+,24?/m1/s1 |
| InChIKey | XJYJJISBCYWCRQ-BEADWONFSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|