C13H30N2O2S — CID 103466329
N-(2,2-dimethylbutyl)-4-(propylamino)butane-1-sulfonamide (PubChem CID 103466329) has the molecular formula C13H30N2O2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-(2,2-dimethylbutyl)-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 103466329 |
| Molecular Formula | C13H30N2O2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)NCC(C)(C)CC |
| InChI | InChI=1S/C13H30N2O2S/c1-5-9-14-10-7-8-11-18(16,17)15-12-13(3,4)6-2/h14-15H,5-12H2,1-4H3 |
| InChIKey | LAKCOZCKPQSDRW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|