C31H41NO6 — CID 10346709
[(3S,10R,13S,16E,17E)-17-hydroxyimino-10,13-dimethyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10346709) has the molecular formula C31H41NO6 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(3S,10R,13S,16E,17E)-17-hydroxyimino-10,13-dimethyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10R,13S,16E,17E)-17-hydroxyimino-10,13-dimethyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10346709 |
| Molecular Formula | C31H41NO6 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | [(3S,10R,13S,16E,17E)-17-hydroxyimino-10,13-dimethyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | COc1cc(/C=C2\CC3C4CC=C5C[C@@H](OC(C)=O)CC[C@]5(C)C4CC[C@]3(C)\C2=N\O)cc(OC)c1OC |
| InChI | InChI=1S/C31H41NO6/c1-18(33)38-22-9-11-30(2)21(17-22)7-8-23-24(30)10-12-31(3)25(23)16-20(29(31)32-34)13-19-14-26(35-4)28(37-6)27(15-19)36-5/h7,13-15,22-25,34H,8-12,16-17H2,1-6H3/b20-13+,32-29+/t22-,23?,24?,25?,30-,31-/m0/s1 |
| InChIKey | DHMSZZBPGVEVKA-MRVJZEQQSA-N |
| XLogP | 6.43 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|