C13H12N4S — CID 103467393
3-amino-6-(4-methylsulfanylanilino)pyridine-2-carbonitrile (PubChem CID 103467393) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-amino-6-(4-methylsulfanylanilino)pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-(4-methylsulfanylanilino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103467393 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-amino-6-(4-methylsulfanylanilino)pyridine-2-carbonitrile |
| SMILES | CSc1ccc(Nc2ccc(N)c(C#N)n2)cc1 |
| InChI | InChI=1S/C13H12N4S/c1-18-10-4-2-9(3-5-10)16-13-7-6-11(15)12(8-14)17-13/h2-7H,15H2,1H3,(H,16,17) |
| InChIKey | ZGDVWDNVEABVFT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |