C11H12N6O3S — CID 103471063
6-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxy-5-nitropyridine-3-carboximidamide (PubChem CID 103471063) has the molecular formula C11H12N6O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 6-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxy-5-nitropyridine-3-carboximidamide.
| Compound Name | 6-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxy-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 103471063 |
| Molecular Formula | C11H12N6O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxy-5-nitropyridine-3-carboximidamide |
| SMILES | Cc1cc(Sc2ncc(/C(N)=N/O)cc2[N+](=O)[O-])n(C)n1 |
| InChI | InChI=1S/C11H12N6O3S/c1-6-3-9(16(2)14-6)21-11-8(17(19)20)4-7(5-13-11)10(12)15-18/h3-5,18H,1-2H3,(H2,12,15) |
| InChIKey | ZYHOQVMNYFAPEB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|