C13H8BrFN4O2 — CID 103471400
6-[(5-bromo-2-fluorophenyl)methylamino]-5-nitropyridine-3-carbonitrile (PubChem CID 103471400) has the molecular formula C13H8BrFN4O2 and a molecular weight of 351.14 g/mol. Its IUPAC name is 6-[(5-bromo-2-fluorophenyl)methylamino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-[(5-bromo-2-fluorophenyl)methylamino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103471400 |
| Molecular Formula | C13H8BrFN4O2 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 6-[(5-bromo-2-fluorophenyl)methylamino]-5-nitropyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NCc2cc(Br)ccc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8BrFN4O2/c14-10-1-2-11(15)9(4-10)7-18-13-12(19(20)21)3-8(5-16)6-17-13/h1-4,6H,7H2,(H,17,18) |
| InChIKey | LACQRTORCXDKPH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|