C12H12N6O2 — CID 106048232
6-[(1,5-dimethylpyrazol-4-yl)methylamino]-5-nitropyridine-3-carbonitrile (PubChem CID 106048232) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 6-[(1,5-dimethylpyrazol-4-yl)methylamino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-[(1,5-dimethylpyrazol-4-yl)methylamino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 106048232 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 6-[(1,5-dimethylpyrazol-4-yl)methylamino]-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1c(CNc2ncc(C#N)cc2[N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C12H12N6O2/c1-8-10(7-16-17(8)2)6-15-12-11(18(19)20)3-9(4-13)5-14-12/h3,5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | YVENZPVYRMFGFP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|