C9H10F4N2O2 — CID 103474101
1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103474101) has the molecular formula C9H10F4N2O2 and a molecular weight of 254.18 g/mol. Its IUPAC name is 1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103474101 |
| Molecular Formula | C9H10F4N2O2 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | OC(COCC(F)(F)C(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H10F4N2O2/c10-8(11)9(12,13)5-17-4-7(16)6-3-14-1-2-15-6/h1-3,7-8,16H,4-5H2 |
| InChIKey | JHGVZJZMXBRBOP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|