C30H26O10 — CID 10347415
(2R,3R,4S)-4-[(2R,3R)-3,5-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 10347415) has the molecular formula C30H26O10 and a molecular weight of 546.53 g/mol. Its IUPAC name is (2R,3R,4S)-4-[(2R,3R)-3,5-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3R,4S)-4-[(2R,3R)-3,5-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 10347415 |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | (2R,3R,4S)-4-[(2R,3R)-3,5-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cccc([C@H]2Oc3ccc([C@H]4c5c(O)cc(O)cc5O[C@H](c5ccc(O)c(O)c5)[C@@H]4O)c(O)c3C[C@H]2O)c1 |
| InChI | InChI=1S/C30H26O10/c31-15-3-1-2-13(8-15)29-22(36)12-18-23(39-29)7-5-17(27(18)37)25-26-21(35)10-16(32)11-24(26)40-30(28(25)38)14-4-6-19(33)20(34)9-14/h1-11,22,25,28-38H,12H2/t22-,25+,28-,29-,30-/m1/s1 |
| InChIKey | HWZCMXJBQCINOX-CWGQGPMUSA-N |
| XLogP | 3.58 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|