C13H21F4NO2 — CID 103475216
1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475216) has the molecular formula C13H21F4NO2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475216 |
| Molecular Formula | C13H21F4NO2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C13H21F4NO2/c14-11(15)13(16,17)8-19-7-10(18)9-2-5-20-12(6-9)3-1-4-12/h9-11H,1-8,18H2 |
| InChIKey | QOTDUXQAZPOFPB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|