C9H14F4O3 — CID 104753405
1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 104753405) has the molecular formula C9H14F4O3 and a molecular weight of 246.20 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 104753405 |
| Molecular Formula | C9H14F4O3 |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | OC(COCC(F)(F)C(F)F)C1CCOC1 |
| InChI | InChI=1S/C9H14F4O3/c10-8(11)9(12,13)5-16-4-7(14)6-1-2-15-3-6/h6-8,14H,1-5H2 |
| InChIKey | CPJJBQHZCDZFER-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|