C10H16F4O2 — CID 103473987
1-cyclobutyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103473987) has the molecular formula C10H16F4O2 and a molecular weight of 244.23 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-cyclobutyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103473987 |
| Molecular Formula | C10H16F4O2 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-cyclobutyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)F)CC1CCC1 |
| InChI | InChI=1S/C10H16F4O2/c11-9(12)10(13,14)6-16-5-8(15)4-7-2-1-3-7/h7-9,15H,1-6H2 |
| InChIKey | NZVQMYFPFOUVNI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|