C16H28F8N2O4 — CID 118376151
1-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl-methylamino]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 118376151) has the molecular formula C16H28F8N2O4 and a molecular weight of 464.39 g/mol. Its IUPAC name is 1-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl-methylamino]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl-methylamino]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 118376151 |
| Molecular Formula | C16H28F8N2O4 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl-methylamino]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | CN(CCN(C)CC(O)COCC(F)(F)C(F)F)CC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C16H28F8N2O4/c1-25(5-11(27)7-29-9-15(21,22)13(17)18)3-4-26(2)6-12(28)8-30-10-16(23,24)14(19)20/h11-14,27-28H,3-10H2,1-2H3 |
| InChIKey | PFXUBXQJVYOSOX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|