C11H21F4NO2 — CID 22975424
1-[di(propan-2-yl)amino]-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol (PubChem CID 22975424) has the molecular formula C11H21F4NO2 and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-[di(propan-2-yl)amino]-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol.
| Compound Name | 1-[di(propan-2-yl)amino]-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 22975424 |
| Molecular Formula | C11H21F4NO2 |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[di(propan-2-yl)amino]-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
| SMILES | CC(C)N(CC(O)COC(F)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C11H21F4NO2/c1-7(2)16(8(3)4)5-9(17)6-18-11(14,15)10(12)13/h7-10,17H,5-6H2,1-4H3 |
| InChIKey | KOWOYITXHWUTPE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|