C8H14F4N2O — CID 103477623
[1-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 103477623) has the molecular formula C8H14F4N2O and a molecular weight of 230.20 g/mol. Its IUPAC name is [1-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477623 |
| Molecular Formula | C8H14F4N2O |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | [1-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)C1CC1 |
| InChI | InChI=1S/C8H14F4N2O/c9-7(10)8(11,12)4-15-3-6(14-13)5-1-2-5/h5-7,14H,1-4,13H2 |
| InChIKey | FPICUSHXBYYXIC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|