C10H17F4NO — CID 104748992
1-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 104748992) has the molecular formula C10H17F4NO and a molecular weight of 243.24 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 104748992 |
| Molecular Formula | C10H17F4NO |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)C1CCCC1 |
| InChI | InChI=1S/C10H17F4NO/c11-9(12)10(13,14)6-16-5-8(15)7-3-1-2-4-7/h7-9H,1-6,15H2 |
| InChIKey | BKASMKLNNGDJHU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|