C12H17F4NO2 — CID 103475733
N-ethyl-1-(furan-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475733) has the molecular formula C12H17F4NO2 and a molecular weight of 283.26 g/mol. Its IUPAC name is N-ethyl-1-(furan-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | N-ethyl-1-(furan-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475733 |
| Molecular Formula | C12H17F4NO2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-ethyl-1-(furan-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CCNC(COCC(F)(F)C(F)F)Cc1ccco1 |
| InChI | InChI=1S/C12H17F4NO2/c1-2-17-9(6-10-4-3-5-19-10)7-18-8-12(15,16)11(13)14/h3-5,9,11,17H,2,6-8H2,1H3 |
| InChIKey | ANNSUFQRCODUCH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|