C12H19F4NO2 — CID 103475828
1-(3,4-dihydro-2H-pyran-5-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475828) has the molecular formula C12H19F4NO2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475828 |
| Molecular Formula | C12H19F4NO2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)C1=COCCC1 |
| InChI | InChI=1S/C12H19F4NO2/c1-2-17-10(9-4-3-5-18-6-9)7-19-8-12(15,16)11(13)14/h6,10-11,17H,2-5,7-8H2,1H3 |
| InChIKey | CUKICXUJNVGUQF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|