C11H14BrF4NOS — CID 103475795
1-(4-bromothiophen-3-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475795) has the molecular formula C11H14BrF4NOS and a molecular weight of 364.20 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475795 |
| Molecular Formula | C11H14BrF4NOS |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)c1cscc1Br |
| InChI | InChI=1S/C11H14BrF4NOS/c1-2-17-9(7-4-19-5-8(7)12)3-18-6-11(15,16)10(13)14/h4-5,9-10,17H,2-3,6H2,1H3 |
| InChIKey | RCGDKEXWJZESKS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|