C11H14ClF4NOS — CID 107360376
1-(3-chlorothiophen-2-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 107360376) has the molecular formula C11H14ClF4NOS and a molecular weight of 319.75 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 107360376 |
| Molecular Formula | C11H14ClF4NOS |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)c1sccc1Cl |
| InChI | InChI=1S/C11H14ClF4NOS/c1-2-17-8(9-7(12)3-4-19-9)5-18-6-11(15,16)10(13)14/h3-4,8,10,17H,2,5-6H2,1H3 |
| InChIKey | VXTROJKJSCTUDW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|