C10H18F4N2O — CID 103477559
[5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-yl]hydrazine (PubChem CID 103477559) has the molecular formula C10H18F4N2O and a molecular weight of 258.26 g/mol. Its IUPAC name is [5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-yl]hydrazine.
| Compound Name | [5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477559 |
| Molecular Formula | C10H18F4N2O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hex-5-en-2-yl]hydrazine |
| SMILES | C=C(C)CCC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C10H18F4N2O/c1-7(2)3-4-8(16-15)5-17-6-10(13,14)9(11)12/h8-9,16H,1,3-6,15H2,2H3 |
| InChIKey | BDZDCOZBPMTAIS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|