C12H10BrClN4O — CID 103481373
N-(2-bromo-3-chlorophenyl)-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 103481373) has the molecular formula C12H10BrClN4O and a molecular weight of 341.60 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103481373 |
| Molecular Formula | C12H10BrClN4O |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2cccc(Cl)c2Br)nn1 |
| InChI | InChI=1S/C12H10BrClN4O/c1-15-10-6-5-9(17-18-10)12(19)16-8-4-2-3-7(14)11(8)13/h2-6H,1H3,(H,15,18)(H,16,19) |
| InChIKey | CSSIJNFMFBTVKI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |