C10H20N4 — CID 103482213
1,5-ditert-butyltriazol-4-amine (PubChem CID 103482213) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 1,5-ditert-butyltriazol-4-amine.
| Compound Name | 1,5-ditert-butyltriazol-4-amine |
|---|---|
| PubChem CID | 103482213 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1,5-ditert-butyltriazol-4-amine |
| SMILES | CC(C)(C)c1c(N)nnn1C(C)(C)C |
| InChI | InChI=1S/C10H20N4/c1-9(2,3)7-8(11)12-13-14(7)10(4,5)6/h11H2,1-6H3 |
| InChIKey | XEXFFVRTNNBYAC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |