C10H18ClN3 — CID 126749913
1,4-ditert-butyl-5-chlorotriazole (PubChem CID 126749913) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is 1,4-ditert-butyl-5-chlorotriazole.
| Compound Name | 1,4-ditert-butyl-5-chlorotriazole |
|---|---|
| PubChem CID | 126749913 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1,4-ditert-butyl-5-chlorotriazole |
| SMILES | CC(C)(C)c1nnn(C(C)(C)C)c1Cl |
| InChI | InChI=1S/C10H18ClN3/c1-9(2,3)7-8(11)14(13-12-7)10(4,5)6/h1-6H3 |
| InChIKey | DZDRONZAGMQVTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |