C12H21N3 — CID 170264051
4-tert-butyl-6,6,7,7-tetramethyl-2,3,4-triazabicyclo[3.2.0]hepta-1(5),2-diene (PubChem CID 170264051) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-tert-butyl-6,6,7,7-tetramethyl-2,3,4-triazabicyclo[3.2.0]hepta-1(5),2-diene.
| Compound Name | 4-tert-butyl-6,6,7,7-tetramethyl-2,3,4-triazabicyclo[3.2.0]hepta-1(5),2-diene |
|---|---|
| PubChem CID | 170264051 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-tert-butyl-6,6,7,7-tetramethyl-2,3,4-triazabicyclo[3.2.0]hepta-1(5),2-diene |
| SMILES | CC(C)(C)n1nnc2c1C(C)(C)C2(C)C |
| InChI | InChI=1S/C12H21N3/c1-10(2,3)15-9-8(13-14-15)11(4,5)12(9,6)7/h1-7H3 |
| InChIKey | YCUGHERVNLLNDV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |