C9H17N3O3 — CID 103482343
1-[2-(2-aminoethoxy)ethyl]-4-methylpiperazine-2,3-dione (PubChem CID 103482343) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)ethyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[2-(2-aminoethoxy)ethyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 103482343 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-[2-(2-aminoethoxy)ethyl]-4-methylpiperazine-2,3-dione |
| SMILES | CN1CCN(CCOCCN)C(=O)C1=O |
| InChI | InChI=1S/C9H17N3O3/c1-11-3-4-12(9(14)8(11)13)5-7-15-6-2-10/h2-7,10H2,1H3 |
| InChIKey | GBCSRRSWRKNIAS-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|