C10H19N3O3 — CID 107506202
1-[3-methoxy-2-(methylamino)propyl]-4-methylpiperazine-2,3-dione (PubChem CID 107506202) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[3-methoxy-2-(methylamino)propyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[3-methoxy-2-(methylamino)propyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 107506202 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-[3-methoxy-2-(methylamino)propyl]-4-methylpiperazine-2,3-dione |
| SMILES | CNC(COC)CN1CCN(C)C(=O)C1=O |
| InChI | InChI=1S/C10H19N3O3/c1-11-8(7-16-3)6-13-5-4-12(2)9(14)10(13)15/h8,11H,4-7H2,1-3H3 |
| InChIKey | YMRWZFUFKLAGFM-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|