C10H23N3O3S — CID 107505701
1-methoxy-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propan-2-amine (PubChem CID 107505701) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is 1-methoxy-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propan-2-amine.
| Compound Name | 1-methoxy-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 107505701 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-methoxy-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propan-2-amine |
| SMILES | CNC(COC)CN1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H23N3O3S/c1-11-10(9-16-2)8-12-4-6-13(7-5-12)17(3,14)15/h10-11H,4-9H2,1-3H3 |
| InChIKey | QRNUNPCNIVBQKM-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |