C15H19N3O2S — CID 103486235
ethyl 3-[2-(1-pyridin-4-ylethylamino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103486235) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 3-[2-(1-pyridin-4-ylethylamino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(1-pyridin-4-ylethylamino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486235 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 3-[2-(1-pyridin-4-ylethylamino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(NC(C)c2ccncc2)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-20-14(19)5-4-13-10-21-15(18-13)17-11(2)12-6-8-16-9-7-12/h6-11H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | RIHOOSIGSIEIGZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |