About 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate
1-ethoxypropan-2-yl 2-morpholin-2-ylacetate (PubChem CID 103488968) has the molecular formula C11H21NO4
and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate |
| PubChem CID | 103488968 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate |
| SMILES | CCOCC(C)OC(=O)CC1CNCCO1 |
| InChI | InChI=1S/C11H21NO4/c1-3-14-8-9(2)16-11(13)6-10-7-12-4-5-15-10/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | RQDIQNUKLNFGTA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate?
The IUPAC name of 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate (CID 103488968) is 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate.
What is the SMILES notation for 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate?
The canonical SMILES for 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate is CCOCC(C)OC(=O)CC1CNCCO1.
What is the InChIKey of 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate?
The InChIKey is RQDIQNUKLNFGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-3-14-8-9(2)16-11(13)6-10-7-12-4-5-15-10/h9-10,12H,3-8H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate?
1-ethoxypropan-2-yl 2-morpholin-2-ylacetate has a molecular weight of 231.29 g/mol, XLogP of 0.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 2-morpholin-2-ylacetate is sourced from PubChem (CID 103488968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).