C14H25NO3 — CID 66434046
(3,4-dimethylcyclohexyl) 2-morpholin-2-ylacetate (PubChem CID 66434046) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl) 2-morpholin-2-ylacetate.
| Compound Name | (3,4-dimethylcyclohexyl) 2-morpholin-2-ylacetate |
|---|---|
| PubChem CID | 66434046 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (3,4-dimethylcyclohexyl) 2-morpholin-2-ylacetate |
| SMILES | CC1CCC(OC(=O)CC2CNCCO2)CC1C |
| InChI | InChI=1S/C14H25NO3/c1-10-3-4-12(7-11(10)2)18-14(16)8-13-9-15-5-6-17-13/h10-13,15H,3-9H2,1-2H3 |
| InChIKey | JESOJCXZLZYTBA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |