About (3-ethylcyclohexyl) 2-morpholin-2-ylacetate
(3-ethylcyclohexyl) 2-morpholin-2-ylacetate (PubChem CID 66433853) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is (3-ethylcyclohexyl) 2-morpholin-2-ylacetate.
Molecular Properties
| Compound Name | (3-ethylcyclohexyl) 2-morpholin-2-ylacetate |
| PubChem CID | 66433853 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (3-ethylcyclohexyl) 2-morpholin-2-ylacetate |
| SMILES | CCC1CCCC(OC(=O)CC2CNCCO2)C1 |
| InChI | InChI=1S/C14H25NO3/c1-2-11-4-3-5-12(8-11)18-14(16)9-13-10-15-6-7-17-13/h11-13,15H,2-10H2,1H3 |
| InChIKey | QFPVIPIBAPGHCW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethylcyclohexyl) 2-morpholin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylcyclohexyl) 2-morpholin-2-ylacetate?
The IUPAC name of (3-ethylcyclohexyl) 2-morpholin-2-ylacetate (CID 66433853) is (3-ethylcyclohexyl) 2-morpholin-2-ylacetate.
What is the SMILES notation for (3-ethylcyclohexyl) 2-morpholin-2-ylacetate?
The canonical SMILES for (3-ethylcyclohexyl) 2-morpholin-2-ylacetate is CCC1CCCC(OC(=O)CC2CNCCO2)C1.
What is the InChIKey of (3-ethylcyclohexyl) 2-morpholin-2-ylacetate?
The InChIKey is QFPVIPIBAPGHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-2-11-4-3-5-12(8-11)18-14(16)9-13-10-15-6-7-17-13/h11-13,15H,2-10H2,1H3.
What are the key properties of (3-ethylcyclohexyl) 2-morpholin-2-ylacetate?
(3-ethylcyclohexyl) 2-morpholin-2-ylacetate has a molecular weight of 255.36 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylcyclohexyl) 2-morpholin-2-ylacetate is sourced from PubChem (CID 66433853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).