C12H25NO4 — CID 103489778
ethyl 3-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)propanoate (PubChem CID 103489778) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is ethyl 3-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)propanoate.
| Compound Name | ethyl 3-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 103489778 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | ethyl 3-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)propanoate |
| SMILES | CCOCC(C)OCC(C)(NC)C(=O)OCC |
| InChI | InChI=1S/C12H25NO4/c1-6-15-8-10(3)17-9-12(4,13-5)11(14)16-7-2/h10,13H,6-9H2,1-5H3 |
| InChIKey | NYCDMGVLXXDRQC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |