C14H27NO3 — CID 106204345
ethyl 4-(2-cyclopropylethoxy)-2-methyl-2-(methylamino)pentanoate (PubChem CID 106204345) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is ethyl 4-(2-cyclopropylethoxy)-2-methyl-2-(methylamino)pentanoate.
| Compound Name | ethyl 4-(2-cyclopropylethoxy)-2-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 106204345 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethyl 4-(2-cyclopropylethoxy)-2-methyl-2-(methylamino)pentanoate |
| SMILES | CCOC(=O)C(C)(CC(C)OCCC1CC1)NC |
| InChI | InChI=1S/C14H27NO3/c1-5-17-13(16)14(3,15-4)10-11(2)18-9-8-12-6-7-12/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | BMWKQNUQGVDQCZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |