C15H31NO4 — CID 103489864
ethyl 6-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)hexanoate (PubChem CID 103489864) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is ethyl 6-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)hexanoate.
| Compound Name | ethyl 6-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)hexanoate |
|---|---|
| PubChem CID | 103489864 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | ethyl 6-(1-ethoxypropan-2-yloxy)-2-methyl-2-(methylamino)hexanoate |
| SMILES | CCOCC(C)OCCCCC(C)(NC)C(=O)OCC |
| InChI | InChI=1S/C15H31NO4/c1-6-18-12-13(3)20-11-9-8-10-15(4,16-5)14(17)19-7-2/h13,16H,6-12H2,1-5H3 |
| InChIKey | RTQPGUAWVRIDHA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|